S144278
3,4-Dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid , 98% , 80866-93-9
CAS NO.：80866-93-9
Empirical Formula: C8H10O4
Molecular Weight: 170.16
MDL number: MFCD00006575
EINECS: 279-596-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB837.19 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170 °C (dec.) (lit.) |
| Boiling point: | 219.79°C (rough estimate) |
| Density | 1.1456 (rough estimate) |
| refractive index | 1.4425 (estimate) |
| InChI | InChI=1S/C8H10O4/c1-8(2)4-5(9)3-6(12-8)7(10)11/h3H,4H2,1-2H3,(H,10,11) |
| InChIKey | ANKQOBXQEHGUJT-UHFFFAOYSA-N |
| SMILES | C1(C)(C)OC(C(O)=O)=CC(=O)C1 |
Description and Uses
3,4-Dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid was used as photoprotective reagent during photolysis of the Salmonella sialidase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | UP6990000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
