S1673249
Synonym(s):
(24S)-24,25-Dihydroxycholecalciferol
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3415.11 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114.6 °C |
| Boiling point: | 571.1±35.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.67±0.29(Predicted) |
| form | Semi-Solid |
| color | White to Off-White |
| Stability: | Light Sensitive, Temperature Sensitive |
| InChIKey | FCKJYANJHNLEEP-WQUHCOROSA-N |
| SMILES | C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2\C(CCC[C@]12C)=C\C=C3\C[C@@H](O)CCC3=C |
Description and Uses
(24S)-Secalciferol is an isomer of Secalciferol (S211500); a metabolite of Vitamin D and a possible anti-inflammatory steroid.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |







