PRODUCT Properties
| Melting point: | 183-185 °C(lit.) |
| alpha | D20 -267° (acetone-methanol) |
| storage temp. | -20°C |
| form | Solid |
| color | Dark Green to Very Dark Green Semi-Solid |
| ε(extinction coefficient) | 15.9 × 104 at 452nm in diethyl ether (lit.) 5.61 × 104 at 644nm in diethyl ether (lit.) |
| Merck | 13,2174 |
| BRN | 4122778 |
| Stability: | Light Sensitive |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | NSMUHPMZFPKNMZ-VBYMZDBQSA-M |
| SMILES | [H]C(=O)c1c(CC)c2cc3c(C)c4C(=O)[C@H](C(=O)OC)c5c6nc(cc7c(C)c(C=C)c(cc1n2)n7[Mg]n3c45)[C@@H](C)[C@@H]6CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| EPA Substance Registry System | Chlorophyll b (519-62-0) |
Description and Uses
Chlorophyll b is a photosynthetic pigment used in the absorption of light energy. Chlorophyl b is involved in photosynthesis and absorbs primarily blue light.
