S1776749
| Pack Size | Price | Stock | Quantity |
| 25μL | RMB1663.03 | In Stock |
|
| 100μL | RMB4389.12 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205 °C (lit.) |
| Boiling point: | 431.5±24.0 °C(Predicted) |
| Density | 1.457±0.06 g/cm3(Predicted) |
| form | solid |
| InChI | 1S/C13H7NO4/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)18-13/h1-7H |
| InChIKey | KWGYGQPIDANWAX-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc-2c(OC(=O)c3ccccc-23)c1 |
Description and Uses
7-Nitro-3,4-benzocoumarin was prepared by the oxidation of 4′-nitrobiphenyl-2-carboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | HP8757700 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |






