S1824350
targetingmouseTcaim
CAS NO.：
Empirical Formula: C4D6O3
Molecular Weight: 108.13
MDL number: MFCD00044225
EINECS: 240-697-0
| Pack Size | Price | Stock | Quantity |
| 20μG | RMB2203.32 | In Stock |
|
| 50μG | RMB3929.25 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -73 °C(lit.) |
| Boiling point: | 138-140 °C(lit.) |
| Density | 1.143 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 130 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| BRN | 1910689 |
| Stability: | Stable, but reacts violently with water. Combustible. Incompatible with strong oxidising agents, alcohols, strong bases. |
| InChI | InChI=1S/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 |
| InChIKey | WFDIJRYMOXRFFG-WFGJKAKNSA-N |
| SMILES | O(C(=O)C([2H])([2H])[2H])C(=O)C([2H])([2H])[2H] |
| CAS Number Unlabeled | 108-24-7 |
Description and Uses
Acetic Anhydride-d6 is the labeled analog of acetic anhydride, a reagent used generally in acetylation reactions in organic chemistry, primarily cellulose acetate and film material.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302+H332-H314 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 10-34-20/22 |
| Safety Statements | 26-45-36/37/39 |
| RIDADR | UN 1715 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 28459010 |
