PRODUCT Properties
| Melting point: | 146-148 °C (lit.) |
| Boiling point: | 459.0±45.0 °C(Predicted) |
| Density | 2.2890 (estimate) |
| pka | pKa 7.5(H2O,(extrap)) (Uncertain) |
| form | solid |
| Merck | 13,5077 |
| InChI | 1S/C11H11I3O3/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5,15H,2-3H2,1H3,(H,16,17) |
| InChIKey | GOIQOQCNFWYSTQ-UHFFFAOYSA-N |
| SMILES | CCC(Cc1c(I)cc(I)c(O)c1I)C(O)=O |
Description and Uses
α-Ethyl-3-hydroxy-2,4,6-triiodohydrocinnamic acid (iophenoxic acid ) was used as marker in “bait acceptance” studies conducted on various animal species. It was used in the direct quantitation of iophenoxic acid in porcine serum samples by a liquid chromatographic-electrospray ionization mass spectrometric technique.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | MW5280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 i.v. in mice: 374 mg/kg (Hoppe) |






