PRODUCT Properties
| Melting point: | 120-122 °C(lit.) |
| Boiling point: | 504.4±50.0 °C(Predicted) |
| Density | 1.385±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder |
| color | Off-white to gray |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19-,20+/m0/s1 |
| InChIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| SMILES | C1Oc2ccc(cc2O1)[C@@H]3OC[C@H]4[C@@H]3CO[C@@H]4c5ccc6OCOc6c5 |
| CAS DataBase Reference | 133-05-1 |
Description and Uses
(-)-Asarinin induces dopamine biosynthesis and protects against 6-OHDA-induced cytotoxicity in rats. Effective as synergists for pyrethrins when used against houseflies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
