S1954049
Megluminediatrizoate , 131-49-7
Synonym(s):
N-Methyl-D-glucamine diatrizoate
CAS NO.：131-49-7
Empirical Formula: C18H26I3N3O9
Molecular Weight: 809.13
MDL number: MFCD00069632
EINECS: 205-024-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1268.64 | In Stock |
|
| 25g | RMB2085.72 | In Stock |
|
| 100g | RMB6512.25 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-193° (dec) |
| Density | 1.9465 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| color | Rhombic needles |
| Odor | sltly sweet taste |
| biological source | synthetic (organic) |
| optical activity | [α]25/D -6.4 to -5.7 °, c =1% (w/v) in water |
| InChIKey | MIKKOBKEXMRYFQ-KUAVVOKVNA-N |
| SMILES | N(C1C(=C(NC(=O)C)C(I)=C(C(=O)O)C=1I)I)C(=O)C.[C@@H](O)([C@@H](O)CNC)[C@H](O)[C@H](O)CO |&1:20,22,27,29,r| |
| EPA Substance Registry System | D-Glucitol, 1-deoxy-1-(methylamino)-, 3,5-bis(acetylamino)-2,4,6-triiodobenzoate (salt) (131-49-7) |
Description and Uses
Medicine (radiopaque medium).
Safety
| WGK Germany | 3 |
| RTECS | LZ4315000 |
| Toxicity | TDLo scu-man: 214 mg/kg 34ZIAG -,392,69 |
