PRODUCT Properties
| Boiling point: | 229 °C (lit.) |
| Density | 0.895 g/mL at 25 °C (lit.) |
| FEMA | 2775 | NERYL ISOBUTYRATE |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Practically insoluble in water, soluble in alcohol and oils. |
| form | liquid |
| Specific Gravity | 0.94 |
| color | Colorless |
| Odor | at 100.00 %. sweet fresh fruity raspberry strawberry green |
| Odor Type | fruity |
| biological source | synthetic |
| JECFA Number | 73 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C14H24O2/c1-11(2)7-6-8-13(5)9-10-16-14(15)12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9- |
| InChIKey | OGJYXQFXLSCKTP-LCYFTJDESA-N |
| SMILES | CC(C)C(=O)OC\C=C(\C)CC\C=C(/C)C |
| LogP | 4.98 |
| EPA Substance Registry System | Propanoic acid, 2-methyl-, (2Z)-3,7-dimethyl-2,6-octadienyl ester (2345-24-6) |
Description and Uses
Neryl isobutyrate has a delicate, sweet, rose-like fragrance with a slightly fruity undertone and a sweet, strawberry taste. May be prepared by esterification of nerol using isobutyric acid or the anhydride.
Neryl isobutyrate finds limited use in fragrance compositions where it may lend richness (“body”) and deep sweetness to Citrus or light floral bases, Rose and novelty types. As a vanant in Honeysuckle, Gardenia, etc. It is used in flavor compositions for sweetness in Citrus flavors and fruit complexes.
Safety
| PPE | Eyeshields, Gloves |
| WGK Germany | 2 |
| RTECS | UA2468500 |
| TSCA | TSCA listed |
| Storage Class | 12 - Non Combustible Liquids |






