S2049149
Corticosteronesolution , 1.0 mg/mLinmethanol,ampuleof1 mL,certifiedreferencematerial,Cerilliant , 50-22-6
CAS NO.：50-22-6
Empirical Formula: C11H13N3O.C4H4O4.C2H6O
Molecular Weight: 365.384
MDL number: MFCD00069224
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB953.44 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: soluble10mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | Soluble to 100 mM in water |
| InChI | 1S/C11H13N3O.C4H4O4/c12-4-3-8-6-14-10-2-1-7(11(13)15)5-9(8)10;5-3(6)1-2-4(7)8/h1-2,5-6,14H,3-4,12H2,(H2,13,15);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PZQZSWAOVAMBQM-BTJKTKAUSA-N |
| SMILES | OC(=O)\C=C/C(O)=O.NCCc1c[nH]c2ccc(cc12)C(N)=O |
Description and Uses
5-Carboxamidotryptamine Maleate Salt Hemiethanolate is a serotonin receptors agonist. Also, it is a 5-HT1A receptor agonists causing cardiovascular effects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |