S2090149
2,4′-DDEsolution , 100 μg/mLinmethanol,PESTANAL ,analyticalstandard , 3424-82-6
Synonym(s):
2-(2-Chlorophenyl)-2-(4-chlorophenyl)-1,1-dichloroethene;2-(2-Chlorophenyl)-2-(4-chlorophenyl)-1,1-dichloroethene solution;o,p′-DDE
CAS NO.:3424-82-6
Empirical Formula: C14H8Cl4
Molecular Weight: 318.03
MDL number: MFCD00036122
EINECS: 222-318-0
| Pack Size | Price | Stock | Quantity |
| 2mL | RMB614.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78.32°C |
| Boiling point: | 403.45°C (rough estimate) |
| Density | 1.3406 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform: Heated; Methanol: Slightly Soluble |
| form | A solid |
| Water Solubility | 0.14mg/L(25 ºC) |
| BRN | 1977640 |
| Stability: | Hygroscopic |
| Major Application | agriculture |
| InChI | 1S/C14H8Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8H |
| InChIKey | ZDYJWDIWLRZXDB-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)\C(=C(\Cl)Cl)c2ccccc2Cl |
| EPA Substance Registry System | o,p'-DDE (3424-82-6) |
Description and Uses
OP-DDE is a DDT metabolite that affects the estrogen and progesterone receptors. It has also been studied as a potential use in treatment of metastatic aderenal carcinoma.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS07,GHS09,GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H351-H410-H225-H301+H311+H331-H370 |
| Precautionary statements | P273-P281-P501-P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 22-40-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37-60-61-45-24-16-7 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 1 |
| RTECS | KV9450000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Toxicity | rat,LD50,oral,880mg/kg (880mg/kg),National Technical Information Service. Vol. PB85-143766, |











