PRODUCT Properties
| Melting point: | 132-134°C |
| Flash point: | 2℃ |
| storage temp. | -20°C Freezer |
| solubility | Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Light Sensitive |
| Major Application | clinical testing |
| InChI | 1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+/i3D3 |
| InChIKey | HPNSFSBZBAHARI-HZIIEIAOSA-N |
| SMILES | C/C(CCC(O)=O)=C\CC1=C(O)C2=C(COC2=O)C(C)=C1OC([2H])([2H])[2H] |
Description and Uses
MYCOPHENOLIC ACID-D3 is used as an internal standard for the quantification of Mycophenolate by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H332-H319-H412-H302+H312+H332 |
| Precautionary statements | P210-P273-P305+P351+P338-P261-P302+P352+P312-P304+P340+P312-P337+P313-P403+P235 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36-52/53 |
| Safety Statements | 16-36/37-61-26 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |





