S2133149
Sodiumtert-pentoxide , 95% , 14593-46-5
CAS NO.：14593-46-5
Empirical Formula: C7H7N3
Molecular Weight: 133.15
MDL number: MFCD00035800
EINECS: 249-921-1
| Pack Size | Price | Stock | Quantity |
| 100g | RMB402.76 | In Stock |
|
| 500g | RMB1161.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-143°C |
| Boiling point: | 360.6±11.0 °C(Predicted) |
| Density | 1.273±0.06 g/cm3(Predicted) |
| storage temp. | Room temperature. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 8.74±0.40(Predicted) |
| color | Dark Orange to Very Dark Brown |
| BRN | 119183 |
| InChI | InChI=1S/C7H7N3/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3,(H,8,9,10) |
| InChIKey | CMGDVUCDZOBDNL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C)C=CC=C2N=N1 |
Description and Uses
A benzotriazole derivative as corrosion inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H319-H412 |
| Precautionary statements | P261-P264-P273-P301+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/22-36-52/53 |
| Safety Statements | 26-61 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |