S2141049
capacity125 mL
Synonym(s):
Kryptand 222B;Kryptofix 222B
CAS NO.:
Empirical Formula: C22H36N2O6
Molecular Weight: 424.53
MDL number: MFCD00013324
EINECS: 250-532-4
| Pack Size | Price | Stock | Quantity |
| 1ea | RMB546.92 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 557.6±50.0 °C(Predicted) |
| Density | 0.995 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 40 °F |
| pka | 7.11±0.20(Predicted) |
| form | liquid |
| BRN | 586455 |
| InChI | 1S/C22H36N2O6/c1-2-4-22-21(3-1)29-15-9-23-5-11-25-17-19-27-13-7-24(10-16-30-22)8-14-28-20-18-26-12-6-23/h1-4H,5-20H2 |
| InChIKey | QXLUTPDNMOEWGG-UHFFFAOYSA-N |
| SMILES | C1COCCN2CCOCCOCCN(CCO1)CCOc3ccccc3OCC2 |
Description and Uses
5,6-Benzo-4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacos-5-ene can be used as a model ligand:
In the metal-ligand complex formation studies to predict ligand coordination with metal ions (Eu & Gd) using magnetic resonance imaging (MRI) technique.
In the study of coordination environment as well as redox and electronic properties of its YbII complexes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H336-H361d-H373-H412 |
| Precautionary statements | P201-P202-P273-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Central nervous system, Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-20-36/37/38-67-65-48/20-38-63 |
| Safety Statements | 16-25-26-29-36/37/39-62-36/37 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 |








