S2266749
purifiedimmunoglobulin,bufferedaqueoussolution
| Pack Size | Price | Stock | Quantity |
| 50μG | RMB3465.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 532.5±60.0 °C(Predicted) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 2.10±0.20(Predicted) |
| color | Off-White to Pale Yellow |
| Major Application | clinical testing |
| InChI | 1S/C15H12ClN3O/c16-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)19(20)9-14(17)18-13/h1-8H,9H2,(H2,17,18) |
| InChIKey | LNLMGKOHYYEWMY-UHFFFAOYSA-N |
| SMILES | ClC1=CC2=C(N=C(N)C[N+]([O-])=C2C3=CC=CC=C3)C=C1 |
Description and Uses
The main metabolite of Chlordiazepoxide (C327050).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H332-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-26-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |






