PRODUCT Properties
| Melting point: | 39-43 °C (lit.) |
| Boiling point: | 84-86 °C(Press: 0.4 Torr) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| form | solid |
| pka | 5.84±0.20(Predicted) |
| InChI | InChI=1S/C6H9NO3/c8-6-4-2-1-3-5(6)7(9)10/h5H,1-4H2 |
| InChIKey | SZNILIWUUKKNPE-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCCC1[N+]([O-])=O |
Description and Uses
The tautomerization rates of 2-nitrocyclohexanone (2-NCH) has been studied spectrophotometrically in several organic aprotic solvents and their binary mixtures.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
