S2349349
affinityisolatedantibody
CAS NO.：
Empirical Formula: C19H23NO4
Molecular Weight: 329.39
MDL number: MFCD00134303
EINECS: 204-094-6
| Pack Size | Price | Stock | Quantity |
| 100μG | RMB3465.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180 °C (dec.)(lit.) |
| alpha | D26 -71° (c = 2.1 in alc) |
| Boiling point: | 466.98°C (rough estimate) |
| Density | 1.2012 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Store at +4°C |
| solubility | Soluble to 65 mg/mL
(197.33 mM) in DMSO |
| pka | 9.72±0.40(Predicted) |
| form | Solid |
| color | White to off-white |
| Merck | 13,8620 |
| InChI | InChI=1/C19H23NO4/c1-20-7-6-19-10-14(21)16(24-3)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9,12-13,22H,6-8,10H2,1-3H3/t12-,13+,19-/s3 |
| InChIKey | YMEVIMJAUHZFMW-VUIDNZEBSA-N |
| SMILES | [C@@]123CCN(C)[C@@H](CC4=CC=C(OC)C(O)=C14)[C@@]2([H])C=C(OC)C(=O)C3 |&1:0,5,16,r| |
| LogP | 1.245 (est) |
Description and Uses
Isolated by Ohta from Cocculus diversifolius DC., this alkaloid forms colourless crystals from MeOH. It is stated to possess a powerful reflex action and to be aspasm stimulant, finally causing paralysis and death in toxic doses. It is also said to suppress the hypotensive action of dihydroxyphenylethanolethylamine.
weak abortifacient, immunosuppressant, analgesic, antiinflammatory; LD50 (po) 580 mg/kg; (ip) 285 mg/kg(mouse)
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H335-H351-H361d-H372 |
| Precautionary statements | P201-P301+P312+P330-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Liver,Kidney, Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | T,Xn |
| Risk Statements | 45-46-23/24/25-36/37/38-20/21/22-48/20/22-40-22-63 |
| Safety Statements | 53-22-26-36/37/39-45-36/37-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | QD2170000 |
| F | 9 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT RE 1 STOT SE 3 |
| Toxicity | LD50 orally in mice: 580 mg/kg (Fu) |
