S237978
3-[(3-Cholamidopropyl)dimethylammonio]-1-propanesulfonate hydrate , 98% , 331717-45-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB538.41 | In Stock |
|
| 5g | RMB1770.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157°C (dec.) (lit.) |
| storage temp. | room temp |
| solubility | H2O: soluble0.1M, clear, colorless |
| form | Solid |
| color | White to off-white |
| biological source | bovine bile |
| Water Solubility | water: 50mg/mL, clear, colorless |
| InChIKey | VCQORVZDSKDOSR-MKZFEOJMNA-N |
| SMILES | C(S([O-])(=O)=O)CC[N+](CCCNC(=O)CC[C@@H](C)[C@@H]1[C@]2(CCC3[C@]4(C)C(CCC3C2CC1)CCCC4)C)(C)C.[H]O[H] |&1:16,18,19,23,r| |
Description and Uses
Zwitterionic detergent for membrane protein solubilization.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Danger |
| Hazard statements | H360-H302-H315-H319 |
| Precautionary statements | P201-P280-P308+P313-P264-P270-P301+P312+P330-P337+P313-P501 |
| Hazard Codes | T,Xi |
| Risk Statements | 61-36/37/38 |
| Safety Statements | 53-26-45-36 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |

![3-[(3-Cholamidopropyl)dimethylammonio]-1-propanesulfonate hydrate](https://img.chemicalbook.com/CAS/20150408/GIF/331717-45-4.gif)

