PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Yellow |
| Major Application | clinical testing |
| InChI | 1S/C20H21N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-14H,7,15H2,1-2H3;1H/i1D3; |
| InChIKey | VXEAYBOGHINOKW-NIIDSAIPSA-N |
| SMILES | Cl.N(CCC=C1c2c(cccc2)C=Cc3c1cccc3)(C([2H])([2H])[2H])C |
Description and Uses
Use as muscle relaxant (skeletal).
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |