S2480449
Ethylacetate , foranalysisEMSURE ACS,ISO,Reag.PhEur , 141-78-6
CAS NO.：141-78-6
Empirical Formula: C9H7D10NO2
Molecular Weight: 181.298
MDL number: MFCD16294730
EINECS: 200-659-6
| Pack Size | Price | Stock | Quantity |
| 1L | RMB366.49 | In Stock |
|
| 2.5L | RMB839.02 | In Stock |
|
| 10L | RMB2738.57 | In Stock |
|
| 25L | RMB4878.06 | In Stock |
|
| 180L | RMB27833.69 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChI | 1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12)/i1D2,2D2,3D2,4D2,5D2 |
| InChIKey | UGJMXCAKCUNAIE-YXALHFAPSA-N |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C(CN)(CC(O)=O)C([2H])([2H])C1([2H])[2H] |
Description and Uses
Gabapentin-d10 is the labelled analogue of Gabapentin (G117250), an amino acid structurally related to γ-Aminobutyric Acid (GABA), designed to cross the blood brain barrier. Used as an anticonvulsant.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |