S2523449
capacity1,000 mL,centerjoint:ST/NS29/32,sidejoint:ST/NS29/32
| Pack Size | Price | Stock | Quantity |
| 1ea | RMB1662.94 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C (lit.) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C3H9S.CH4O4S/c1-4(2)3;1-5-6(2,3)4/h1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ANXKZXRDXAZQJT-UHFFFAOYSA-M |
| SMILES | [S+](C)(C)C.S([O-])(=O)(=O)OC |
Description and Uses
Useful reagent for the methylenation of aldehydes and ketones to form epoxides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





