S2533949
100 μg/mLinmethanol,ampuleof1 mL,certifiedreferencematerial,Cerilliant , 1062605-69-9
Synonym(s):
(±)−O-Desmethylvenlafaxine-D6 solution
CAS NO.：1062605-69-9
Empirical Formula: C16H19D6NO2
Molecular Weight: 269.41
MDL number: MFCD07369295
EINECS: 200-659-6
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB2588.14 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219-221°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Major Application | clinical testing |
| InChI | 1S/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3/i1D3,2D3 |
| InChIKey | KYYIDSXMWOZKMP-WFGJKAKNSA-N |
| SMILES | OC1=CC=C(C(CN(C([2H])([2H])[2H])C([2H])([2H])[2H])C2(O)CCCCC2)C=C1 |
Description and Uses
D,L-O-Desmethyl Venlafaxine-d6, is the labeled analogue of D,L-O-Desmethyl Venlafaxine (D296500), a metabolite of Venlafaxine (V120000).
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
