S2545549
volume5-50 μL,Micro-tip
Synonym(s):
Lithium tributylmagnesate in hexanes/ether
| Pack Size | Price | Stock | Quantity |
| 1ea | RMB3679.28 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.769 g/mL at 25 °C |
| Flash point: | -25 °C |
| storage temp. | 2-8°C |
| InChI | 1S/3C4H9.Li.Mg/c3*1-3-4-2;;/h3*1,3-4H2,2H3;;/q;;;+1;-1 |
| InChIKey | MYNWCAJLXIFFBO-UHFFFAOYSA-N |
| SMILES | [Li+].CCCC[Mg-](CCCC)CCCC |
Description and Uses
Tri-n-butyllithium magnesate is a base and deprotonating agent used in the deprotonation of furans, fluoro aromatics, thiophenes, oxazoles and benzoxazoles.
Safety
| Symbol(GHS) |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H411 |
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi,N,Xn |
| Risk Statements | 11-14-19-22-38-51/53-65-66-67 |
| Safety Statements | 61-62-16 |
| RIDADR | UN 1155 3/PG 1 |
| WGK Germany | 3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
