PRODUCT Properties
| Melting point: | 152-155 °C |
| Boiling point: | 510.5±30.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | ethanol: 1mg/mL |
| Colour Index | 12010 |
| pka | 8.39±0.40(Predicted) |
| form | powder |
| color | brown to dark brown |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | HAIR DYEING COLORANT |
| InChI | 1S/C18H16N2O2/c1-2-22-14-9-7-13(8-10-14)19-20-17-11-12-18(21)16-6-4-3-5-15(16)17/h3-12,21H,2H2,1H3/b20-19+ |
| InChIKey | JSEYDVLGSMLKDL-FMQUCBEESA-N |
| SMILES | CCOc1ccc(cc1)\N=N\c2ccc(O)c3ccccc23 |
| LogP | 3.824 (est) |
| EPA Substance Registry System | 1-Naphthalenol, 4-[(4-ethoxyphenyl)azo]- (6535-42-8) |
Description and Uses
Fat Brown B is a stain/dye. Dyes and metabolites.
Safety
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
