PRODUCT Properties
| Melting point: | -15.1°C |
| Boiling point: | 128 °C/750 mmHg (lit.) |
| Density | 0.887 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 93 °F |
| storage temp. | Storage temp. 2-8°C |
| pka | 15.10±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5H10O/c1-5(4-6)2-3-5/h6H,2-4H2,1H3 |
| InChIKey | PIZQWRXTMGASCZ-UHFFFAOYSA-N |
| SMILES | C1(C)(CO)CC1 |
| LogP | 0.720 (est) |
| NIST Chemistry Reference | 1-Methylcyclopropanemethanol(2746-14-7) |
Description and Uses
1-Methylcyclopropanemethanol has been used in the preparation of (±)-2-(benzyloxycarbonylamino)-2-(1′-methylcyclopropyl)ethanamide.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H225 |
| Precautionary statements | P210-P403+P235 |
| Risk Statements | 10 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
