S3005451
UnitedStatesPharmacopeia(USP)ReferenceStandard , 177530-93-7
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB11804.14 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109oC |
| Boiling point: | 340.6±42.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.24±0.40(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H9ClF3NO2/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8/h3-4,7-8H,1-2H2,(H,19,20) |
| InChIKey | XPOQHMRABVBWPR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C2(OC(=O)Nc3c2cc(cc3)Cl)C#CC1CC1 |
Description and Uses
rac Efavirenz is a mixture of both enantiomers for Efavirenz (E425000), a nonnucleoside HIV-1 reverse transcriptase inhibitor. Antiviral.
Safety
| WGK Germany | WGK 3 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
