PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | room temp |
| Colour Index | 62058 |
| form | Solid:particulate/powder |
| λmax | 629 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C23H20N2O5S.Na/c1-11-8-12(2)21(13(3)9-11)25-16-10-17(31(28,29)30)20(24)19-18(16)22(26)14-6-4-5-7-15(14)23(19)27;/h4-10,25H,24H2,1-3H3,(H,28,29,30);/q;+1/p-1 |
| InChIKey | RRETZLLHOMHNNB-UHFFFAOYSA-M |
| SMILES | C12C(=O)C3=C(C=CC=C3)C(=O)C1=C(N)C(S([O-])(=O)=O)=CC=2NC1=C(C)C=C(C)C=C1C.[Na+] |
| CAS DataBase Reference | 6397-02-0 |
| EPA Substance Registry System | 2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-9,10-dioxo-4-[(2,4,6-trimethylphenyl)amino]-, monosodium salt (6397-02-0) |
Description and Uses
Acid Blue 129 is a dye/stain. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB1035000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



