S306878
(S)-(?)-N-(Trifluoroacetyl)pyrrolidine-2-carbonyl chloride solution , 0.1?Minmethylenechloride , 36724-68-2
Synonym(s):
(S)-(−)-N-(Trifluoroacetyl)prolyl chloride solution;TPC
| Pack Size | Price | Stock | Quantity |
| 5g | RMB198.34 | In Stock |
|
| 25g | RMB652.84 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 306.2±42.0 °C(Predicted) |
| Density | 1.308 g/mL at 25 °C |
| refractive index | n |
| storage temp. | 2-8°C |
| pka | -4.06±0.40(Predicted) |
| BRN | 480791 |
| InChI | 1S/C7H7ClF3NO2/c8-5(13)4-2-1-3-12(4)6(14)7(9,10)11/h4H,1-3H2/t4-/m0/s1 |
| InChIKey | NUOYJPPISCCYDH-BYPYZUCNSA-N |
| SMILES | FC(F)(F)C(=O)N1CCC[C@H]1C(Cl)=O |
Description and Uses
(S)-()-N-(Trifluoroacetyl)pyrrolidine-2-carbonyl chloride can be used as a chiral derivatization reagent:
- In the chiral separation of psychoactive, cathinone- and amphetamine-related drugsusing GC-MS technique.
- In the estimation of cathinone related drug enantiomers in biological samples like urine and plasma using GC-MS technique.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H336-H351-H373 |
| Precautionary statements | P261-P281-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 40-52-67-36/37/38 |
| Safety Statements | 23-24/25-36/37-26 |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 2 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








