S322679
Bis(tert-butylimino)bis(dimethylamino)tungsten(VI) , packagedforuseindepositionsystems , 406462-43-9
| Pack Size | Price | Stock | Quantity |
| 10g | RMB5923.49 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 81 °C0.02 mm Hg(lit.) |
| Density | 1.305 g/mL at 25 °C(lit.) |
| Flash point: | 57 °F |
| form | liquid |
| color | yellow |
| Sensitive | air sensitive, moisture sensitive |
| InChI | InChI=1S/2C4H9N.2C2H6N.W/c2*1-4(2,3)5;2*1-3-2;/h2*1-3H3;2*1-2H3;/q;;2*-1;+2 |
| InChIKey | JVCWKXBYGCJHDF-UHFFFAOYSA-N |
| SMILES | [W](N(C)C)(N(C)C)(=NC(C)(C)C)=NC(C)(C)C |
| CAS DataBase Reference | 406462-43-9 |
Description and Uses
Precursor for the deposition of tungsten carbide and -nitride by atomic layer deposition.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H260-H314 |
| Precautionary statements | P223-P231+P232-P280-P302+P335+P334-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-15-34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN 3398 4.3/PG 1 |
| WGK Germany | 3 |
| HazardClass | 4.3 |
| Excepted Quantities | Not Permitted as Excepted Quantity |
