PRODUCT Properties
| Melting point: | 70-70.5 °C |
| Boiling point: | 113-115 °C(Press: 3 Torr) |
| Density | 0.987±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.38±0.10(Predicted) |
| color | Pale Beige to Light Beige |
| InChI | InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) |
| InChIKey | MUCMKTPAZLSKTL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC(O)CCCCCCCCC |
| LogP | 3.110 (est) |
Description and Uses
3-Hydroxylauric Acid is used in the study of Lipid A, a major constituent of the lipopolysaccharides, which are responsible for the toxicity of gram negative bacteria. Also used in the synthesis of olefins from β-hydroxy carboxylic acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






