S336978
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine iron(III) chloride , 28755-93-3
CAS NO.:28755-93-3
Empirical Formula: C36H44ClFeN4
Molecular Weight: 624.07
MDL number: MFCD00011614
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB661.51 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | solid |
| color | Brown to black |
| λmax | 382 nm |
| InChIKey | NWWCYXFDLUMYRQ-YAJYDHHFSA-M |
| SMILES | CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Fe](Cl)n34)c(CC)c5CC |
Description and Uses
Fe(III) Octaethylporphine chloride is a synthetic porphyrin used to reduce oxygen and study heme.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






