S338078
Pentacosafluoro-1-iodododecane , 97% , 307-60-8
Synonym(s):
1-Iodoperfluorododecane;Perfluorododecyl iodide
CAS NO.：307-60-8
Empirical Formula: C12F25I
Molecular Weight: 745.99
MDL number: MFCD00001066
EINECS: 206-205-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB438.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C (lit.) |
| Boiling point: | 108-110 °C/18 mmHg (lit.) |
| Density | 1.9588 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 1718343 |
| InChI | 1S/C12F25I/c13-1(14,3(17,18)5(21,22)7(25,26)9(29,30)11(33,34)35)2(15,16)4(19,20)6(23,24)8(27,28)10(31,32)12(36,37)38 |
| InChIKey | WBYCUETVRCXUPE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| NIST Chemistry Reference | 1-Iodoperfluorododecane(307-60-8) |
| EPA Substance Registry System | Dodecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodo- (307-60-8) |
Description and Uses
Pentacosafluoro-1-iodododecane (1-Iodoperfluorododecane) has been used in E-screen assay to investigate the estrogenic activities of polyfluorinated iodine alkanes in MCF-7 cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2903780090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
