S353080
α-Ketoglutaric acid sodium salt , ≥98%(titration) , 22202-68-2
Synonym(s):
2-Oxoglutaric acid monosodium salt;2-Oxopentanedioic acid monosodium salt;Sodium 2-oxoglutarate monobasic
CAS NO.:22202-68-2
Empirical Formula: C5H5NaO5
Molecular Weight: 168.08
MDL number: MFCD00064196
EINECS: 244-836-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB536.72 | In Stock |
|
| 5g | RMB833.36 | In Stock |
|
| 25g | RMB2351.21 | In Stock |
|
| 100g | RMB3812.77 | In Stock |
|
| 1kg | RMB23188.14 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless |
| form | Powder |
| color | White |
| Water Solubility | water: 100mg/mL, clear, colorless |
| BRN | 4597521 |
| Stability: | Hygroscopic |
| InChI | 1S/C5H6O5.Na/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | MOTOGHHLNTXPTI-UHFFFAOYSA-M |
| SMILES | [Na+].OC(=O)CCC(=O)C([O-])=O |
Description and Uses
α-Ketoglutaric acid sodium salt has been used in the human kynurenine amino transferase II (KAT II) inhibition spectra assay.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |



