S3572651
PESTANAL ,analyticalstandard , 41198-08-7
CAS NO.:41198-08-7
Empirical Formula: C11H15BrClO3PS
Molecular Weight: 373.63
MDL number: MFCD00078736
EINECS: 255-255-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB736.29 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 110°C (0.001 torr) |
| Density | d20 1.455 |
| vapor pressure | 1.24×10-4 Pa (25 °C) |
| refractive index | n20D 1.5466 |
| Flash point: | 124℃ |
| storage temp. | APPROX 4°C |
| solubility | DMSO: 50 mg/mL (133.82 mM) |
| Water Solubility | 28 mg l-1 (25 °C) |
| form | Oily Liquid |
| Specific Gravity | 1.455 (20℃) |
| color | Colorless to light yellow |
| Merck | 13,7860 |
| BRN | 2150258 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H15BrClO3PS/c1-3-7-18-17(14,15-4-2)16-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | QYMMJNLHFKGANY-UHFFFAOYSA-N |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(Br)cc1Cl |
| LogP | 4.2 at 25℃ |
| CAS DataBase Reference | 41198-08-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphorothioic acid, o-(4-bromo-2-chlorophenyl) o-ethyl s-propyl ester(41198-08-7) |
| EPA Substance Registry System | Profenofos (41198-08-7) |
Description and Uses
Profenofos is a pale yellow liquid, bp 100 ?C/1.80 Pa, vp 0.124 mPa (25 ?C). Solubility in water is 28 mg/L (25 ?C). It is miscible with most organic solvents. Log Kow = 4.44. It is relatively stable in neutral and mild acid media but hydrolyzed in alkaline media; DT50 values (20 ?C) at pH 5, 7, and 9 are 93 d, 14.6 d, and 5.7 h, respectively.
Profenofos is used to control insects (particularly caterpillars and Lepidoptera eggs) and mites on cotton, maize, sugar beet, soyabean, potatoes, vegetables, tobacco and a number of other crops
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H317-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N,T |
| Risk Statements | 20/21/22-50/53-24-20/22-43 |
| Safety Statements | 36/37-60-61-45-9-7 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TE6975000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 41198-08-7(Hazardous Substances Data) |
| Toxicity | LD50 in rat (mg/kg): 358-400 orally; ~3300 dermally; LC50 (4 hr) in rat (mg/m3): ~3000 by inhalation (Buholzer); LC50 (96 hr) in rainbow fish: 0.91 mg/l (Kumar, Chapman). |




