S377279
≥95%(HPLC) , 548-82-3
Synonym(s):
(2R,3R)-3,5,7-Trihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one;(2R,3R)-3,5,7-Trihydroxy-2-phenyl-chroman-4-one;(2R,3R)-3,5,7-Trihydroxyflavanone
| Pack Size | Price | Stock | Quantity |
| 2mg | RMB2128.29 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-175 °C(Solv: methanol (67-56-1)) |
| Boiling point: | 570.6±50.0 °C(Predicted) |
| Density | 1.497±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.40±0.60(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 91238 |
| Stability: | Hygroscopic |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
| InChIKey | SUYJZKRQHBQNCA-LSDHHAIUSA-N |
| SMILES | O=C1[C@@H]([C@@H](C2C=CC=CC=2)OC2=CC(=CC(=C21)O)O)O |
| LogP | 3.150 (est) |
Description and Uses
rac-Pinobanksin is a dihydroflavonol that posesses antioxidant properties. Pinobanksin is most commonly found in propolis, a material utilized by bees in the construction of their hives.
Safety
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
