S378178
N-Acetylprocainamide , ≥99% , 32795-44-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB397.21 | In Stock |
|
| 1g | RMB962.54 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C(lit.) |
| Boiling point: | 500.0±35.0 °C(Predicted) |
| Density | 1.097±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | soluble1%, clear, colorless to faintly yellow (1N HCl) |
| pka | 14.54±0.46(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | soluble 1%, clear, colorless to faintly yellow (1N HCl) |
| Merck | 13,20 |
| InChI | 1S/C15H23N3O2/c1-4-18(5-2)11-10-16-15(20)13-6-8-14(9-7-13)17-12(3)19/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | KEECCEWTUVWFCV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(C)=O)cc1 |
Description and Uses
antiprotozoal
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | AE1974350 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
