S379678
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II) , 97% , 24803-99-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB924.17 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| form | solid |
| λmax | 392 nm |
| InChIKey | DIGQQRGHPATISA-XTPDIVBZSA-N |
| SMILES | CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Ni]n34)c(CC)c5CC |
Description and Uses
Nickel octaethylporphyrin can be synthesized by the metalation of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine with nickel (II).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
