S381479
Zirconium carboxyethyl acrylate , 60%(n-propanol) , 123633-53-4
CAS NO.:123633-53-4
Empirical Formula: C24H28O16Zr
Molecular Weight: 663.69
MDL number: MFCD10566999
| Pack Size | Price | Stock | Quantity |
| 100g | RMB2246.95 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-121 °C |
| Density | 1.101 g/mL at 25 °C |
| Flash point: | 15℃ |
| form | liquid |
| Specific Gravity | 1.1 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/4C6H8O4.Zr/c4*1-2-6(9)10-4-3-5(7)8;/h4*2H,1,3-4H2,(H,7,8);/q;;;;+4/p-4 |
| InChIKey | XQEXAYLRUODZQC-UHFFFAOYSA-J |
| SMILES | C=CC(=O)OCCC(=O)O[Zr](OC(=O)CCOC(=O)C=C)(OC(=O)CCOC(=O)C=C)OC(=O)CCOC(=O)C=C |
Description and Uses
Zirconium-containing multifunctional acrylate useful for producing cured, transparent films with high refractive indices.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H318-H335-H336 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Central nervous system, Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-37/38-41-67 |
| Safety Statements | 26-36/37/39-39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |




