PRODUCT Properties
Melting point: | 171°C |
Boiling point: | 350.95°C (rough estimate) |
Density | 1.0694 (rough estimate) |
refractive index | 1.5780 (estimate) |
storage temp. | Refrigerator |
solubility | Chloroform, Methanol |
form | Solid |
color | Crystals from MeOH (aq) |
InChI | InChI=1S/C14H13NO/c1-11(16)15-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,15,16) |
InChIKey | SVLDILRDQOVJED-UHFFFAOYSA-N |
SMILES | C(NC1=CC=C(C2=CC=CC=C2)C=C1)(=O)C |
EPA Substance Registry System | Acetamide, N-[1,1'-biphenyl]-4-yl- (4075-79-0) |
Description and Uses
N-Acetyl-4-aminobiphenyl is a metabolite of 4-Aminobiphenyl, a procarcinogenic agent.
Safety
Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
Signal word | Warning |
Hazard statements | H312-H315-H319-H332-H302-H335-H351 |
Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P201-P202-P281-P308+P313-P405-P501 |
Hazardous Substances Data | 4075-79-0(Hazardous Substances Data) |
Toxicity | TDLo orl-rat: 2770 mg/kg/21W-C:CAR CNREA8 15,188,55 orl-rat TD:4070 mg/kg/34W-C:CAR CNREA8 16,525,56 |