PRODUCT Properties
| Melting point: | 211-213 °C(lit.) |
| form | solid |
| InChI | 1S/C9H5Cl3N2O/c10-9(11,12)8-13-6-4-2-1-3-5(6)7(15)14-8/h1-4H,(H,13,14,15) |
| InChIKey | BFLBZZSGIIUGIX-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C1=Nc2ccccc2C(=O)N1 |
Description and Uses
Acid dissociation constant of 2-trichloromethyl-4(3H)-quinazolinone has been determined in aqueous solution.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
