S413179
Phosphoric acid 2-hydroxyethyl methacrylate ester , contains700-1000 ppmmonomethyletherhydroquinone,90% , 52628-03-2
CAS NO.：52628-03-2
Empirical Formula: C6H13O7P
Molecular Weight: 228.14
MDL number: MFCD00128921
EINECS: 258-053-2
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB559.06 | In Stock |
|
| 250ml | RMB1102.47 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 129.7℃[at 101 325 Pa] |
| Density | 1.37 g/mL at 25 °C |
| vapor pressure | 10.11hPa at 20℃ |
| refractive index | n20/D 1.4688 |
| Flash point: | 145 °C |
| storage temp. | 2-8°C |
| form | liquid |
| Water Solubility | 25g/L at 25℃ |
| Cosmetics Ingredients Functions | NAIL CONDITIONING |
| InChI | InChI=1S/C6H10O3.H3O4P/c1-5(2)6(8)9-4-3-7;1-5(2,3)4/h7H,1,3-4H2,2H3;(H3,1,2,3,4) |
| InChIKey | POLZHVHESHDZRD-UHFFFAOYSA-N |
| SMILES | C(=O)(OCCO)C(=C)C.P(O)(O)(O)=O |
| LogP | 2.72 at 30℃ |
| EPA Substance Registry System | 2-Hydroxyethyl methacrylate phosphate (52628-03-2) |
Description and Uses
Phosphoric acid 2-hydroxyethyl methacrylate ester is used in surface functionalization of polytetrafluoroethylene (PTFE) for craniofacial applications.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290-H302-H314-H335 |
| Precautionary statements | P234-P261-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
