S4237151
analyticalstandard , 486-67-9
Synonym(s):
2-(3-Hydroxymercurio-2-methoxypropylcarbamoyl)phenoxyacetic acid;2-[N-(3-Hydroxymercuri-2-methoxypropyl)carbamoyl]phenoxyacetic acid;Salyrganic acid
CAS NO.：486-67-9
Empirical Formula: C13H17HgNO6
Molecular Weight: 483.87
MDL number: MFCD00004302
EINECS: 207-637-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1478.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-193 °C (dec.)(lit.) |
| solubility | NH4OH: clear to hazy |
| Merck | 13,5928 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C13H16NO5.Hg.H2O/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);;1H2/q;+1;/p-1 |
| InChIKey | HQRSUIDICNOLPX-UHFFFAOYSA-M |
| SMILES | COC(CNC(=O)c1ccccc1OCC(O)=O)C[Hg]O |
| CAS DataBase Reference | 486-67-9 |
Description and Uses
Sulfhydryl specific biochemical probe.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H410 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-33-50/53 |
| Safety Statements | 13-28-36-45-60-61 |
| RIDADR | UN 2025 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
