S4275751
EuropeanPharmacopoeia(EP)ReferenceStandard , 78246-49-8
Synonym(s):
(3S-trans)-3-[(1,3-Benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine hydrochloride hemihydrate;Paroxetine hydrochloride hemihydrate
CAS NO.:78246-49-8
Empirical Formula: C19H21ClFNO3
Molecular Weight: 365.83
MDL number: MFCD00797405
EINECS: 616-601-1
| Pack Size | Price | Stock | Quantity |
| Y0000578 | RMB1158.21 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-131°C |
| storage temp. | 2-8°C |
| solubility | insoluble in H2O; ≥17.8 mg/mL in EtOH; ≥18.29 mg/mL in DMSO |
| form | Solid |
| color | White to off-white |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1/C19H20FNO3.ClH/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18;/h1-6,9,14,17,21H,7-8,10-12H2;1H/t14-,17-;/s3 |
| InChIKey | GELRVIPPMNMYGS-ZXIWTAKENA-N |
| SMILES | N1CC[C@@H](C2=CC=C(F)C=C2)[C@H](COC2=CC=C3OCOC3=C2)C1.[H]Cl |&1:3,11,r| |
| CAS DataBase Reference | 78246-49-8(CAS DataBase Reference) |
Description and Uses
A selective serotonin reuptake inhibitor. Used as an antidepressant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RIDADR | 3249 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339900 |






