S428580
Porphobilinogen , powder , 487-90-1
Synonym(s):
5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrole-3-propanoic acid
CAS NO.:487-90-1
Empirical Formula: C10H14N2O4
Molecular Weight: 226.23
MDL number: MFCD00005224
EINECS: 207-666-3
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB807.94 | In Stock |
|
| 5mg | RMB2312.58 | In Stock |
|
| 10mg | RMB4269.33 | In Stock |
|
| 50mg | RMB15704.97 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-177℃ |
| Boiling point: | 479℃ |
| Density | 1.421 |
| Flash point: | 243℃ |
| storage temp. | -20°C |
| solubility | Aqueous Base (Slightly), Acetonitrile (Slightly), DMSO (Slightly) |
| pka | 4.22±0.10(Predicted) |
| form | powder |
| color | light yellow to pink |
| Merck | 13,7681 |
| BRN | 220051 |
| InChI | 1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
| InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| SMILES | NCc1[nH]cc(CCC(O)=O)c1CC(O)=O |
| EPA Substance Registry System | Porphobilinogen (487-90-1) |
Description and Uses
An intermediate in the biosynthesis of Heme, found in the urine of patients with acute porphyria.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







