S438278
2-Bromoheptane , technicalgrade , 1974-04-5
Synonym(s):
1-Methylhexyl bromide
CAS NO.:1974-04-5
Empirical Formula: C7H15Br
Molecular Weight: 179.1
MDL number: MFCD00000164
EINECS: 217-824-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB516.46 | In Stock |
|
| 100g | RMB1640.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47°C |
| Boiling point: | 64-66 °C/21 mmHg (lit.) |
| Density | 1.142 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 117 °F |
| BRN | 1731556 |
| InChI | InChI=1S/C7H15Br/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3 |
| InChIKey | HLAUCEOFCOXKNF-UHFFFAOYSA-N |
| SMILES | CC(Br)CCCCC |
| CAS DataBase Reference | 1974-04-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Heptane, 2-bromo-(1974-04-5) |
| EPA Substance Registry System | Heptane, 2-bromo- (1974-04-5) |
Description and Uses
2-Bromoheptane has been used in the preparation of:
- racemic alcohol, 2-methylheptanol
- glutathione (GSH) derivatives
- GSH analog that contains tetrazole isostere (Tet-sHep)
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |




