S4485451
≥98%(TLC),powder , 96861-65-3
Synonym(s):
MIA
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB2143.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-192°C |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 8.96±0.46(Predicted) |
| color | Light Yellow to Yellow |
| biological source | rabbit |
| InChI | 1S/C11H18ClN7O/c1-5(2)4-19(3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | RVIUMPLAOXSSGN-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C)c1nc(N)c(nc1Cl)C(=O)NC(N)=N |
Description and Uses
5-(N-Methyl-N-isobutyl)-Amiloride is an NHE inhibitor. Inhibits bacterial and mitochondrial NADH-quinone oxidoreductase (complex I).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
