S454478
4-Dimethylamino-2,2,6,6-tetramethylpiperidine , 96% , 32327-90-5
Synonym(s):
N,N,2,2,6,6-Hexamethyl-4-piperidinamine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB473.54 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 213.5±8.0 °C(Predicted) |
| Density | 0.88±0.1 g/cm3(Predicted) |
| refractive index | n |
| Flash point: | 120 °F |
| pka | 10.83±0.10(Predicted) |
| InChI | 1S/C11H24N2/c1-10(2)7-9(13(5)6)8-11(3,4)12-10/h9,12H,7-8H2,1-6H3 |
| InChIKey | LRAJIZNKBMCWJE-UHFFFAOYSA-N |
| SMILES | CN(C)C1CC(C)(C)NC(C)(C)C1 |
Description and Uses
Reactant for:
Self-aggregation of supramolecules of nitroxides
Synthesis of unsymmetrical spin-labeled bolaamphiphiles
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |





![Hexahydro-2,6-bis(2,2,6,6-tetramethyl-4-piperidinyl)-1H,4H,5H,8H-2,3a,4a,6,7a,8a-hexaazacyclopenta[def]fluorene-4,8-dione](https://img.chemicalbook.com/CAS/GIF/109423-00-9.gif)