S456578
Triton? X-114, reduced , reduced , 92046-34-9
Synonym(s):
Polyoxyethylene (40) isooctylcyclohexyl ether
CAS NO.:92046-34-9
Empirical Formula: C34H62O11
Molecular Weight: 646.849
MDL number: MFCD00132505
EINECS: 682-156-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB563.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-50 °C(lit.) |
| Boiling point: | 270 °C |
| Density | 1.065 g/mL at 20 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 0.005 M at 20 °C, clear, colorless |
| form | Viscous, colorless liquid |
| color | ≤100(APHA) |
| biological source | synthetic (oragnic) |
| Water Solubility | water: soluble, clear to slightly hazy, colorless |
| InChI | 1S/C28H56O8/c1-27(2,3)24-28(4,5)25-6-8-26(9-7-25)36-23-22-35-21-20-34-19-18-33-17-16-32-15-14-31-13-12-30-11-10-29/h25-26,29H,6-24H2,1-5H3 |
| InChIKey | QQJNBKDKLMCALZ-UHFFFAOYSA-N |
| SMILES | O(C1CCC(CC1)C(CC(C)(C)C)(C)C)CCOCCOCCOCCOCCOCCOCCO |
| Absorption | ≤0.25 at 277nm in H2O at 0.5% |
Description and Uses
TRITON X-100 Detergent, Hydrogenated is a nonionic detergent used to solubilize membrane-bound proteins.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H411 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-41-51/53-36/37/38 |
| Safety Statements | 26-61-36/37-36/39 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MD0907700 |
| F | 3-8-23 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




