S470779
97% , 111060-63-0
Synonym(s):
(S)-2-(Dibenzylamino)propanal;N,N-Dibenzyl-L -alaninal
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1858.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 346.2±30.0 °C(Predicted) |
| Density | 1.067±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | crystals |
| pka | 5.79±0.50(Predicted) |
| optical activity | [α]/D -36.0±2.0°, c = 1 in ethanol |
| BRN | 4293933 |
| InChI | 1S/C17H19NO/c1-15(14-19)18(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,14-15H,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | GFYXFRCVQSKSDO-HNNXBMFYSA-N |
| SMILES | C[C@@H](C=O)N(Cc1ccccc1)Cc2ccccc2 |
Description and Uses
(S)-(-)-2-(Dibenzylamino)propionaldehyde can be employed as a building block for the preparation of:
- Linezolid dipeptide derivatives and 3-oxazolidin-2-one analogs.
- (2R,3S)-3-Dibenzylamine-1-nitrobutan-2-ol by reacting with bromonitromethane via nitro-aldol reaction using SmI2 as a catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-43-52 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
