S4748052
≥95%,FCC,FG , 10094-34-5
CAS NO.:10094-34-5
Empirical Formula: C14H20O2
Molecular Weight: 220.31
MDL number: MFCD00027132
EINECS: 233-221-8
| Pack Size | Price | Stock | Quantity |
| 1SAMPLE-K | RMB317.38 | In Stock |
|
| 1KG | RMB1285.62 | In Stock |
|
| 5KG | RMB4173.15 | In Stock |
|
| 10KG | RMB6897.97 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 237-255 °C(lit.) |
| Density | 0.969 g/mL at 25 °C(lit.) |
| vapor pressure | 0.164Pa at 20℃ |
| FEMA | 2394 | ALPHA,ALPHA-DIMETHYLPHENETHYL BUTYRATE |
| refractive index | n |
| Flash point: | >230 °F |
| Specific Gravity | 0.96 |
| color | Colorless liquid |
| Odor | plum aroma |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | 16.11mg/L at 20℃ |
| JECFA Number | 1656 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C14H20O2/c1-4-8-13(15)16-14(2,3)11-12-9-6-5-7-10-12/h5-7,9-10H,4,8,11H2,1-3H3 |
| InChIKey | SHSGYHAHMQLYRB-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC(C)(C)Cc1ccccc1 |
| LogP | 4.7 at 25℃ |
| CAS DataBase Reference | 10094-34-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanoic acid, 1,1-dimethyl-2-phenylethyl ester(10094-34-5) |
| EPA Substance Registry System | Butanoic acid, 1,1-dimethyl-2-phenylethyl ester (10094-34-5) |
Description and Uses
Benzyldimethylcarbinyl butyrate is used in perfume compositions of the Oriental-Rose, Chypre, Peony and other types, often as a modifier for other D. M.B.C. esters.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H412 |
| Precautionary statements | P273-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N |
| Risk Statements | 38-43-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | ET0130000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Skin Irrit. 2 |
| Toxicity | LD50 orl-rat: >5 g/kg FCTXAV 18,667,80 |





